C22H16BrN3O4 — CID 126302722
3-[5-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]furan-2-yl]benzoic acid (PubChem CID 126302722) has the molecular formula C22H16BrN3O4 and a molecular weight of 466.29 g/mol. Its IUPAC name is 3-[5-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126302722 |
| Molecular Formula | C22H16BrN3O4 |
| Molecular Weight | 466.29 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | 3-[5-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]furan-2-yl]benzoic acid |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(-c2cccc(C(=O)O)c2)o1 |
| InChI | InChI=1S/C22H16BrN3O4/c1-2-20-25-18-8-6-15(23)11-17(18)21(27)26(20)24-12-16-7-9-19(30-16)13-4-3-5-14(10-13)22(28)29/h3-12H,2H2,1H3,(H,28,29) |
| InChIKey | IIXQZEYMFZUNGH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.29 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|