C25H22BrN3O4 — CID 126284349
4-[5-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]furan-2-yl]-3-methylbenzoic acid (PubChem CID 126284349) has the molecular formula C25H22BrN3O4 and a molecular weight of 508.37 g/mol. Its IUPAC name is 4-[5-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]furan-2-yl]-3-methylbenzoic acid.
| Compound Name | 4-[5-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]furan-2-yl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 126284349 |
| Molecular Formula | C25H22BrN3O4 |
| Molecular Weight | 508.37 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 4-[5-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]furan-2-yl]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1-c1ccc(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)o1 |
| InChI | InChI=1S/C25H22BrN3O4/c1-14-11-15(23(31)32)5-8-18(14)21-10-7-17(33-21)13-27-29-22(30)19-12-16(26)6-9-20(19)28-24(29)25(2,3)4/h5-13H,1-4H3,(H,31,32) |
| InChIKey | DATBWUGSUOKLIR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.37 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|