C19H17BrFN3O — CID 126307066
6-bromo-2-tert-butyl-3-[(4-fluorophenyl)methylideneamino]quinazolin-4-one (PubChem CID 126307066) has the molecular formula C19H17BrFN3O and a molecular weight of 402.27 g/mol. Its IUPAC name is 6-bromo-2-tert-butyl-3-[(4-fluorophenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-tert-butyl-3-[(4-fluorophenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126307066 |
| Molecular Formula | C19H17BrFN3O |
| Molecular Weight | 402.27 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 6-bromo-2-tert-butyl-3-[(4-fluorophenyl)methylideneamino]quinazolin-4-one |
| SMILES | CC(C)(C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H17BrFN3O/c1-19(2,3)18-23-16-9-6-13(20)10-15(16)17(25)24(18)22-11-12-4-7-14(21)8-5-12/h4-11H,1-3H3 |
| InChIKey | YTGBZKRKCZPRDJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.27 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|