C24H21Br2N3O2 — CID 126291154
6-bromo-3-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-2-tert-butylquinazolin-4-one (PubChem CID 126291154) has the molecular formula C24H21Br2N3O2 and a molecular weight of 543.26 g/mol. Its IUPAC name is 6-bromo-3-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-2-tert-butylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-2-tert-butylquinazolin-4-one |
|---|---|
| PubChem CID | 126291154 |
| Molecular Formula | C24H21Br2N3O2 |
| Molecular Weight | 543.26 g/mol |
| Exact Mass | 541.00 |
| IUPAC Name | 6-bromo-3-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-2-tert-butylquinazolin-4-one |
| SMILES | Cc1ccc(-c2ccc(C=Nn3c(C(C)(C)C)nc4ccc(Br)cc4c3=O)o2)c(Br)c1 |
| InChI | InChI=1S/C24H21Br2N3O2/c1-14-5-8-17(19(26)11-14)21-10-7-16(31-21)13-27-29-22(30)18-12-15(25)6-9-20(18)28-23(29)24(2,3)4/h5-13H,1-4H3 |
| InChIKey | WDCUKVQCFITXAI-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 60.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.26 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|