C26H27BrN4O — CID 126283695
3-[(1-benzyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one (PubChem CID 126283695) has the molecular formula C26H27BrN4O and a molecular weight of 491.43 g/mol. Its IUPAC name is 3-[(1-benzyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one.
| Compound Name | 3-[(1-benzyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one |
|---|---|
| PubChem CID | 126283695 |
| Molecular Formula | C26H27BrN4O |
| Molecular Weight | 491.43 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 3-[(1-benzyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one |
| SMILES | Cc1cc(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C26H27BrN4O/c1-17-13-20(18(2)30(17)16-19-9-7-6-8-10-19)15-28-31-24(32)22-14-21(27)11-12-23(22)29-25(31)26(3,4)5/h6-15H,16H2,1-5H3 |
| InChIKey | AWKJWNFOLASEMT-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.43 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|