C24H21BrClN3O2 — CID 126322672
6-bromo-2-[(2S)-butan-2-yl]-3-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylideneamino]quinazolin-4-one (PubChem CID 126322672) has the molecular formula C24H21BrClN3O2 and a molecular weight of 498.81 g/mol. Its IUPAC name is 6-bromo-2-[(2S)-butan-2-yl]-3-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126322672 |
| Molecular Formula | C24H21BrClN3O2 |
| Molecular Weight | 498.81 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(-c2ccc(C)c(Cl)c2)o1 |
| InChI | InChI=1S/C24H21BrClN3O2/c1-4-14(2)23-28-21-9-7-17(25)12-19(21)24(30)29(23)27-13-18-8-10-22(31-18)16-6-5-15(3)20(26)11-16/h5-14H,4H2,1-3H3/t14-/m0/s1 |
| InChIKey | YSKJSTYXOUYSMF-AWEZNQCLSA-N |
| XLogP | 6.78 |
| TPSA | 60.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.81 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|