C21H14BrCl2N3O2 — CID 126282492
6-bromo-3-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-ethylquinazolin-4-one (PubChem CID 126282492) has the molecular formula C21H14BrCl2N3O2 and a molecular weight of 491.17 g/mol. Its IUPAC name is 6-bromo-3-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-ethylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 126282492 |
| Molecular Formula | C21H14BrCl2N3O2 |
| Molecular Weight | 491.17 g/mol |
| Exact Mass | 488.96 |
| IUPAC Name | 6-bromo-3-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-ethylquinazolin-4-one |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C21H14BrCl2N3O2/c1-2-20-26-18-7-4-13(22)10-15(18)21(28)27(20)25-11-14-5-8-19(29-14)12-3-6-16(23)17(24)9-12/h3-11H,2H2,1H3 |
| InChIKey | PSXSWEZYCREPAQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 60.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.17 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|