C24H19BrClN3O4 — CID 126327590
4-[5-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]furan-2-yl]-2-chlorobenzoic acid (PubChem CID 126327590) has the molecular formula C24H19BrClN3O4 and a molecular weight of 528.79 g/mol. Its IUPAC name is 4-[5-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]furan-2-yl]-2-chlorobenzoic acid.
| Compound Name | 4-[5-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]furan-2-yl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 126327590 |
| Molecular Formula | C24H19BrClN3O4 |
| Molecular Weight | 528.79 g/mol |
| Exact Mass | 527.02 |
| IUPAC Name | 4-[5-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]furan-2-yl]-2-chlorobenzoic acid |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(-c2ccc(C(=O)O)c(Cl)c2)o1 |
| InChI | InChI=1S/C24H19BrClN3O4/c1-3-13(2)22-28-20-8-5-15(25)11-18(20)23(30)29(22)27-12-16-6-9-21(33-16)14-4-7-17(24(31)32)19(26)10-14/h4-13H,3H2,1-2H3,(H,31,32)/t13-/m1/s1 |
| InChIKey | HPTTVDSVPCEUII-CYBMUJFWSA-N |
| XLogP | 6.17 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.79 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|