C9H7BrN4 — CID 5391184
(Z)-1-(4-bromophenyl)-N-(1H-1,2,4-triazol-5-yl)methanimine (PubChem CID 5391184) has the molecular formula C9H7BrN4 and a molecular weight of 251.09 g/mol. Its IUPAC name is (Z)-1-(4-bromophenyl)-N-(1H-1,2,4-triazol-5-yl)methanimine.
| Compound Name | (Z)-1-(4-bromophenyl)-N-(1H-1,2,4-triazol-5-yl)methanimine |
|---|---|
| PubChem CID | 5391184 |
| Molecular Formula | C9H7BrN4 |
| Molecular Weight | 251.09 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | (Z)-1-(4-bromophenyl)-N-(1H-1,2,4-triazol-5-yl)methanimine |
| SMILES | Brc1ccc(/C=N\c2ncn[nH]2)cc1 |
| InChI | InChI=1S/C9H7BrN4/c10-8-3-1-7(2-4-8)5-11-9-12-6-13-14-9/h1-6H,(H,12,13,14)/b11-5- |
| InChIKey | JOIZFRMJHFJOJW-WZUFQYTHSA-N |
| XLogP | 2.32 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.09 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|