C9H8N4O2 — CID 135699033
4-[(E)-1H-1,2,4-triazol-5-yliminomethyl]benzene-1,2-diol (PubChem CID 135699033) has the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. Its IUPAC name is 4-[(E)-1H-1,2,4-triazol-5-yliminomethyl]benzene-1,2-diol.
| Compound Name | 4-[(E)-1H-1,2,4-triazol-5-yliminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135699033 |
| Molecular Formula | C9H8N4O2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 4-[(E)-1H-1,2,4-triazol-5-yliminomethyl]benzene-1,2-diol |
| SMILES | Oc1ccc(/C=N/c2ncn[nH]2)cc1O |
| InChI | InChI=1S/C9H8N4O2/c14-7-2-1-6(3-8(7)15)4-10-9-11-5-12-13-9/h1-5,14-15H,(H,11,12,13)/b10-4+ |
| InChIKey | FZMLZZCOUSWBFV-ONNFQVAWSA-N |
| XLogP | 0.97 |
| TPSA | 94.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|