C10H9N3O3S — CID 676702
2-[(3,4-dihydroxyphenyl)methylideneamino]-4H-1,3,4-thiadiazin-5-one (PubChem CID 676702) has the molecular formula C10H9N3O3S and a molecular weight of 251.27 g/mol. Its IUPAC name is 2-[(3,4-dihydroxyphenyl)methylideneamino]-4H-1,3,4-thiadiazin-5-one.
| Compound Name | 2-[(3,4-dihydroxyphenyl)methylideneamino]-4H-1,3,4-thiadiazin-5-one |
|---|---|
| PubChem CID | 676702 |
| Molecular Formula | C10H9N3O3S |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 2-[(3,4-dihydroxyphenyl)methylideneamino]-4H-1,3,4-thiadiazin-5-one |
| SMILES | O=C1CSC(N=Cc2ccc(O)c(O)c2)=NN1 |
| InChI | InChI=1S/C10H9N3O3S/c14-7-2-1-6(3-8(7)15)4-11-10-13-12-9(16)5-17-10/h1-4,14-15H,5H2,(H,12,16) |
| InChIKey | ILEATRQBBCTPGF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|