C14H12N2O3 — CID 708103
2-[(3,4-dihydroxyphenyl)methylideneamino]benzamide (PubChem CID 708103) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-[(3,4-dihydroxyphenyl)methylideneamino]benzamide.
| Compound Name | 2-[(3,4-dihydroxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 708103 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-[(3,4-dihydroxyphenyl)methylideneamino]benzamide |
| SMILES | NC(=O)c1ccccc1/N=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H12N2O3/c15-14(19)10-3-1-2-4-11(10)16-8-9-5-6-12(17)13(18)7-9/h1-8,17-18H,(H2,15,19)/b16-8+ |
| InChIKey | AFYXSRSPVGUSAK-LZYBPNLTSA-N |
| XLogP | 1.95 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|