C9H8N4O2S — CID 135779483
4-[(5-amino-1,2,4-thiadiazol-3-yl)iminomethyl]benzene-1,2-diol (PubChem CID 135779483) has the molecular formula C9H8N4O2S and a molecular weight of 236.26 g/mol. Its IUPAC name is 4-[(5-amino-1,2,4-thiadiazol-3-yl)iminomethyl]benzene-1,2-diol.
| Compound Name | 4-[(5-amino-1,2,4-thiadiazol-3-yl)iminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135779483 |
| Molecular Formula | C9H8N4O2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 4-[(5-amino-1,2,4-thiadiazol-3-yl)iminomethyl]benzene-1,2-diol |
| SMILES | Nc1nc(N=Cc2ccc(O)c(O)c2)ns1 |
| InChI | InChI=1S/C9H8N4O2S/c10-8-12-9(13-16-8)11-4-5-1-2-6(14)7(15)3-5/h1-4,14-15H,(H2,10,12,13) |
| InChIKey | KVFNGPAWFFQTIO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|