C10H15NO5Si — CID 139211832
4-(3-trihydroxysilylpropyliminomethyl)benzene-1,2-diol (PubChem CID 139211832) has the molecular formula C10H15NO5Si and a molecular weight of 257.32 g/mol. Its IUPAC name is 4-(3-trihydroxysilylpropyliminomethyl)benzene-1,2-diol.
| Compound Name | 4-(3-trihydroxysilylpropyliminomethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 139211832 |
| Molecular Formula | C10H15NO5Si |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-(3-trihydroxysilylpropyliminomethyl)benzene-1,2-diol |
| SMILES | Oc1ccc(/C=N/CCC[Si](O)(O)O)cc1O |
| InChI | InChI=1S/C10H15NO5Si/c12-9-3-2-8(6-10(9)13)7-11-4-1-5-17(14,15)16/h2-3,6-7,12-16H,1,4-5H2/b11-7+ |
| InChIKey | COYLWVBXPMRTIO-YRNVUSSQSA-N |
| XLogP | -0.18 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|