C17H18N2O2 — CID 91295364
3-[3-[(3-hydroxyphenyl)methylideneamino]propyliminomethyl]phenol (PubChem CID 91295364) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-[3-[(3-hydroxyphenyl)methylideneamino]propyliminomethyl]phenol.
| Compound Name | 3-[3-[(3-hydroxyphenyl)methylideneamino]propyliminomethyl]phenol |
|---|---|
| PubChem CID | 91295364 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3-[3-[(3-hydroxyphenyl)methylideneamino]propyliminomethyl]phenol |
| SMILES | Oc1cccc(/C=N/CCC/N=C/c2cccc(O)c2)c1 |
| InChI | InChI=1S/C17H18N2O2/c20-16-6-1-4-14(10-16)12-18-8-3-9-19-13-15-5-2-7-17(21)11-15/h1-2,4-7,10-13,20-21H,3,8-9H2/b18-12+,19-13+ |
| InChIKey | DFNKWHHMXCFTLH-KLCVKJMQSA-N |
| XLogP | 3.03 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|