C22H28N2O4 — CID 136828234
4-[6-[(4-hydroxy-3-methoxyphenyl)methylideneamino]hexyliminomethyl]-2-methoxyphenol (PubChem CID 136828234) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-[6-[(4-hydroxy-3-methoxyphenyl)methylideneamino]hexyliminomethyl]-2-methoxyphenol.
| Compound Name | 4-[6-[(4-hydroxy-3-methoxyphenyl)methylideneamino]hexyliminomethyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 136828234 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 4-[6-[(4-hydroxy-3-methoxyphenyl)methylideneamino]hexyliminomethyl]-2-methoxyphenol |
| SMILES | COc1cc(/C=N/CCCCCC/N=C/c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C22H28N2O4/c1-27-21-13-17(7-9-19(21)25)15-23-11-5-3-4-6-12-24-16-18-8-10-20(26)22(14-18)28-2/h7-10,13-16,25-26H,3-6,11-12H2,1-2H3/b23-15+,24-16+ |
| InChIKey | DEJSFAAYXQZLPQ-DFEHQXHXSA-N |
| XLogP | 4.21 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|