C13H20N2O2 — CID 70090398
3-[(3,4-dimethoxyphenyl)methylideneamino]-N-methylpropan-1-amine (PubChem CID 70090398) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methylideneamino]-N-methylpropan-1-amine.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methylideneamino]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 70090398 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methylideneamino]-N-methylpropan-1-amine |
| SMILES | CNCCC/N=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H20N2O2/c1-14-7-4-8-15-10-11-5-6-12(16-2)13(9-11)17-3/h5-6,9-10,14H,4,7-8H2,1-3H3/b15-10+ |
| InChIKey | NVTYJUXXNUAYHO-XNTDXEJSSA-N |
| XLogP | 1.73 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|