C11H14KNO5S — CID 170554766
potassium 2-[(3,4-dimethoxyphenyl)methylideneamino]ethanesulfonate (PubChem CID 170554766) has the molecular formula C11H14KNO5S and a molecular weight of 311.40 g/mol. Its IUPAC name is potassium 2-[(3,4-dimethoxyphenyl)methylideneamino]ethanesulfonate.
| Compound Name | potassium 2-[(3,4-dimethoxyphenyl)methylideneamino]ethanesulfonate |
|---|---|
| PubChem CID | 170554766 |
| Molecular Formula | C11H14KNO5S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | potassium 2-[(3,4-dimethoxyphenyl)methylideneamino]ethanesulfonate |
| SMILES | COc1ccc(/C=N/CCS(=O)(=O)[O-])cc1OC.[K+] |
| InChI | InChI=1S/C11H15NO5S.K/c1-16-10-4-3-9(7-11(10)17-2)8-12-5-6-18(13,14)15;/h3-4,7-8H,5-6H2,1-2H3,(H,13,14,15);/q;+1/p-1/b12-8+; |
| InChIKey | XZBBNUPNUVCPIO-MXZHIVQLSA-M |
| XLogP | -2.33 |
| TPSA | 88.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|