C14H15N2O4S+ — CID 2242402
N-[(3,4-dimethoxyphenyl)methylidene]pyridin-1-ium-3-sulfonamide (PubChem CID 2242402) has the molecular formula C14H15N2O4S+ and a molecular weight of 307.35 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methylidene]pyridin-1-ium-3-sulfonamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methylidene]pyridin-1-ium-3-sulfonamide |
|---|---|
| PubChem CID | 2242402 |
| Molecular Formula | C14H15N2O4S+ |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methylidene]pyridin-1-ium-3-sulfonamide |
| SMILES | COc1ccc(C=NS(=O)(=O)c2ccc[nH+]c2)cc1OC |
| InChI | InChI=1S/C14H14N2O4S/c1-19-13-6-5-11(8-14(13)20-2)9-16-21(17,18)12-4-3-7-15-10-12/h3-10H,1-2H3/p+1 |
| InChIKey | YPKFNDWHULVGSZ-UHFFFAOYSA-O |
| XLogP | 1.33 |
| TPSA | 79.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|