C23H32N2O4Si — CID 11102030
1-(3,4-dimethoxyphenyl)-N-[3-(2-methyl-6-phenyl-1,3,6,2-dioxazasilocan-2-yl)propyl]methanimine (PubChem CID 11102030) has the molecular formula C23H32N2O4Si and a molecular weight of 428.61 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-[3-(2-methyl-6-phenyl-1,3,6,2-dioxazasilocan-2-yl)propyl]methanimine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-[3-(2-methyl-6-phenyl-1,3,6,2-dioxazasilocan-2-yl)propyl]methanimine |
|---|---|
| PubChem CID | 11102030 |
| Molecular Formula | C23H32N2O4Si |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-[3-(2-methyl-6-phenyl-1,3,6,2-dioxazasilocan-2-yl)propyl]methanimine |
| SMILES | COc1ccc(/C=N/CCC[Si]2(C)OCCN(c3ccccc3)CCO2)cc1OC |
| InChI | InChI=1S/C23H32N2O4Si/c1-26-22-11-10-20(18-23(22)27-2)19-24-12-7-17-30(3)28-15-13-25(14-16-29-30)21-8-5-4-6-9-21/h4-6,8-11,18-19H,7,12-17H2,1-3H3/b24-19+ |
| InChIKey | YYSHKQXYHYZKNK-LYBHJNIJSA-N |
| XLogP | 4.14 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|