C14H18F6N3O2P — CID 139076706
2-methoxy-4-[2-(3-methylimidazol-3-ium-1-yl)ethyliminomethyl]phenol hexafluorophosphate (PubChem CID 139076706) has the molecular formula C14H18F6N3O2P and a molecular weight of 405.28 g/mol. Its IUPAC name is 2-methoxy-4-[2-(3-methylimidazol-3-ium-1-yl)ethyliminomethyl]phenol hexafluorophosphate.
| Compound Name | 2-methoxy-4-[2-(3-methylimidazol-3-ium-1-yl)ethyliminomethyl]phenol hexafluorophosphate |
|---|---|
| PubChem CID | 139076706 |
| Molecular Formula | C14H18F6N3O2P |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2-methoxy-4-[2-(3-methylimidazol-3-ium-1-yl)ethyliminomethyl]phenol hexafluorophosphate |
| SMILES | COc1cc(/C=N/CCn2cc[n+](C)c2)ccc1O.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C14H17N3O2.F6P/c1-16-7-8-17(11-16)6-5-15-10-12-3-4-13(18)14(9-12)19-2;1-7(2,3,4,5)6/h3-4,7-11H,5-6H2,1-2H3;/q;-1/p+1 |
| InChIKey | MVCOWICMDKCMNJ-UHFFFAOYSA-O |
| XLogP | 4.53 |
| TPSA | 50.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|