C15H23N4O2+3 — CID 2018872
2-methoxy-4-(1,3,5-triazoniatricyclo[3.3.1.13,7]decan-7-yliminomethyl)phenol (PubChem CID 2018872) has the molecular formula C15H23N4O2+3 and a molecular weight of 291.38 g/mol. Its IUPAC name is 2-methoxy-4-(1,3,5-triazoniatricyclo[3.3.1.13,7]decan-7-yliminomethyl)phenol.
| Compound Name | 2-methoxy-4-(1,3,5-triazoniatricyclo[3.3.1.13,7]decan-7-yliminomethyl)phenol |
|---|---|
| PubChem CID | 2018872 |
| Molecular Formula | C15H23N4O2+3 |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-methoxy-4-(1,3,5-triazoniatricyclo[3.3.1.13,7]decan-7-yliminomethyl)phenol |
| SMILES | COc1cc(/C=N/C23C[NH+]4C[NH+](C[NH+](C4)C2)C3)ccc1O |
| InChI | InChI=1S/C15H20N4O2/c1-21-14-4-12(2-3-13(14)20)5-16-15-6-17-9-18(7-15)11-19(8-15)10-17/h2-5,20H,6-11H2,1H3/p+3/b16-5+ |
| InChIKey | IOLHGIVZUULFPP-FZSIALSZSA-Q |
| XLogP | -3.87 |
| TPSA | 55.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | -3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|