C18H17ClN4O2S — CID 25251022
(E)-1-[4-[2-(4-chlorophenyl)sulfanylethoxy]-3-methoxyphenyl]-N-(1H-1,2,4-triazol-5-yl)methanimine (PubChem CID 25251022) has the molecular formula C18H17ClN4O2S and a molecular weight of 388.88 g/mol. Its IUPAC name is (E)-1-[4-[2-(4-chlorophenyl)sulfanylethoxy]-3-methoxyphenyl]-N-(1H-1,2,4-triazol-5-yl)methanimine.
| Compound Name | (E)-1-[4-[2-(4-chlorophenyl)sulfanylethoxy]-3-methoxyphenyl]-N-(1H-1,2,4-triazol-5-yl)methanimine |
|---|---|
| PubChem CID | 25251022 |
| Molecular Formula | C18H17ClN4O2S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | (E)-1-[4-[2-(4-chlorophenyl)sulfanylethoxy]-3-methoxyphenyl]-N-(1H-1,2,4-triazol-5-yl)methanimine |
| SMILES | COc1cc(/C=N/c2ncn[nH]2)ccc1OCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClN4O2S/c1-24-17-10-13(11-20-18-21-12-22-23-18)2-7-16(17)25-8-9-26-15-5-3-14(19)4-6-15/h2-7,10-12H,8-9H2,1H3,(H,21,22,23)/b20-11+ |
| InChIKey | VPEYDORYPUDWJR-RGVLZGJSSA-N |
| XLogP | 4.39 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|