C32H35N5O4S — CID 170869875
4-[3-[4-[[5-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxymethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]propyl]morpholine (PubChem CID 170869875) has the molecular formula C32H35N5O4S and a molecular weight of 585.73 g/mol. Its IUPAC name is 4-[3-[4-[[5-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxymethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]propyl]morpholine.
| Compound Name | 4-[3-[4-[[5-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxymethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]propyl]morpholine |
|---|---|
| PubChem CID | 170869875 |
| Molecular Formula | C32H35N5O4S |
| Molecular Weight | 585.73 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | 4-[3-[4-[[5-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxymethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]propyl]morpholine |
| SMILES | Cc1ccc(OCc2nnc(Sc3ccc(CCCN4CCOCC4)cc3[N+](=O)[O-])n2-c2ccccc2)c2c1CCC2 |
| InChI | InChI=1S/C32H35N5O4S/c1-23-12-14-29(27-11-5-10-26(23)27)41-22-31-33-34-32(36(31)25-8-3-2-4-9-25)42-30-15-13-24(21-28(30)37(38)39)7-6-16-35-17-19-40-20-18-35/h2-4,8-9,12-15,21H,5-7,10-11,16-20,22H2,1H3 |
| InChIKey | STZFCFTWHLAHCP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 95.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.73 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|