C22H20N4O2S2 — CID 4075173
1-benzyl-3-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]thiourea (PubChem CID 4075173) has the molecular formula C22H20N4O2S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 1-benzyl-3-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]thiourea.
| Compound Name | 1-benzyl-3-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 4075173 |
| Molecular Formula | C22H20N4O2S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 1-benzyl-3-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]thiourea |
| SMILES | Cc1ccc(Sc2ccc(C=NNC(=S)NCc3ccccc3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H20N4O2S2/c1-16-7-10-19(11-8-16)30-21-12-9-18(13-20(21)26(27)28)15-24-25-22(29)23-14-17-5-3-2-4-6-17/h2-13,15H,14H2,1H3,(H2,23,25,29) |
| InChIKey | NMRJLGWTWDZQNP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|