C15H14N4O2S — CID 6164365
1-benzyl-3-[(Z)-(2-nitrophenyl)methylideneamino]thiourea (PubChem CID 6164365) has the molecular formula C15H14N4O2S and a molecular weight of 314.37 g/mol. Its IUPAC name is 1-benzyl-3-[(Z)-(2-nitrophenyl)methylideneamino]thiourea.
| Compound Name | 1-benzyl-3-[(Z)-(2-nitrophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 6164365 |
| Molecular Formula | C15H14N4O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 1-benzyl-3-[(Z)-(2-nitrophenyl)methylideneamino]thiourea |
| SMILES | O=[N+]([O-])c1ccccc1/C=N\NC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C15H14N4O2S/c20-19(21)14-9-5-4-8-13(14)11-17-18-15(22)16-10-12-6-2-1-3-7-12/h1-9,11H,10H2,(H2,16,18,22)/b17-11- |
| InChIKey | LCFBQDCCVOXJBJ-BOPFTXTBSA-N |
| XLogP | 2.59 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|