C23H22N4O6S2 — CID 6878920
[4-[(E)-(benzylcarbamothioylhydrazinylidene)methyl]-2-ethoxyphenyl] 2-nitrobenzenesulfonate (PubChem CID 6878920) has the molecular formula C23H22N4O6S2 and a molecular weight of 514.59 g/mol. Its IUPAC name is [4-[(E)-(benzylcarbamothioylhydrazinylidene)methyl]-2-ethoxyphenyl] 2-nitrobenzenesulfonate.
| Compound Name | [4-[(E)-(benzylcarbamothioylhydrazinylidene)methyl]-2-ethoxyphenyl] 2-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 6878920 |
| Molecular Formula | C23H22N4O6S2 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | [4-[(E)-(benzylcarbamothioylhydrazinylidene)methyl]-2-ethoxyphenyl] 2-nitrobenzenesulfonate |
| SMILES | CCOc1cc(/C=N/NC(=S)NCc2ccccc2)ccc1OS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H22N4O6S2/c1-2-32-21-14-18(16-25-26-23(34)24-15-17-8-4-3-5-9-17)12-13-20(21)33-35(30,31)22-11-7-6-10-19(22)27(28)29/h3-14,16H,2,15H2,1H3,(H2,24,26,34)/b25-16+ |
| InChIKey | BJVHNDMAPIOJPU-PCLIKHOPSA-N |
| XLogP | 3.76 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|