C17H15BClF3N4O2S — CID 170875299
3-[[5-(6-chloro-3-pyridinyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]propylboronic acid (PubChem CID 170875299) has the molecular formula C17H15BClF3N4O2S and a molecular weight of 442.66 g/mol. Its IUPAC name is 3-[[5-(6-chloro-3-pyridinyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]propylboronic acid.
| Compound Name | 3-[[5-(6-chloro-3-pyridinyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]propylboronic acid |
|---|---|
| PubChem CID | 170875299 |
| Molecular Formula | C17H15BClF3N4O2S |
| Molecular Weight | 442.66 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 3-[[5-(6-chloro-3-pyridinyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]propylboronic acid |
| SMILES | OB(O)CCCSc1nnc(-c2ccc(Cl)nc2)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15BClF3N4O2S/c19-14-6-5-11(10-23-14)15-24-25-16(29-8-2-7-18(27)28)26(15)13-4-1-3-12(9-13)17(20,21)22/h1,3-6,9-10,27-28H,2,7-8H2 |
| InChIKey | QMISLCHVMIYRKI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.66 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|