C21H17F3N4O2S — CID 27944205
2-[[5-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide (PubChem CID 27944205) has the molecular formula C21H17F3N4O2S and a molecular weight of 446.45 g/mol. Its IUPAC name is 2-[[5-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide.
| Compound Name | 2-[[5-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 27944205 |
| Molecular Formula | C21H17F3N4O2S |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 2-[[5-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CSc1nnc(-c2ccc(OC)cc2)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H17F3N4O2S/c1-3-11-25-18(29)13-31-20-27-26-19(14-7-9-17(30-2)10-8-14)28(20)16-6-4-5-15(12-16)21(22,23)24/h1,4-10,12H,11,13H2,2H3,(H,25,29) |
| InChIKey | QYKJGKRSHOUWFV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|