C19H18F3N5O2S — CID 2609383
N-(2-methoxyethyl)-2-[[5-pyridin-3-yl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 2609383) has the molecular formula C19H18F3N5O2S and a molecular weight of 437.45 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[5-pyridin-3-yl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[[5-pyridin-3-yl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2609383 |
| Molecular Formula | C19H18F3N5O2S |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[5-pyridin-3-yl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COCCNC(=O)CSc1nnc(-c2cccnc2)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18F3N5O2S/c1-29-9-8-24-16(28)12-30-18-26-25-17(13-4-3-7-23-11-13)27(18)15-6-2-5-14(10-15)19(20,21)22/h2-7,10-11H,8-9,12H2,1H3,(H,24,28) |
| InChIKey | YPSIXEKPQZOLRT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|