C29H22F3N5O3S — CID 135782089
N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-[[5-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 135782089) has the molecular formula C29H22F3N5O3S and a molecular weight of 577.59 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-[[5-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-[[5-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 135782089 |
| Molecular Formula | C29H22F3N5O3S |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 577.14 |
| IUPAC Name | N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-[[5-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(-c2nnc(SCC(=O)N/N=C\c3c(O)ccc4ccccc34)n2-c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C29H22F3N5O3S/c1-40-22-12-9-19(10-13-22)27-35-36-28(37(27)21-7-4-6-20(15-21)29(30,31)32)41-17-26(39)34-33-16-24-23-8-3-2-5-18(23)11-14-25(24)38/h2-16,38H,17H2,1H3,(H,34,39)/b33-16- |
| InChIKey | YUOKBOMSWLXKQD-BJUCDSOZSA-N |
| XLogP | 6.06 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|