C13H13F3N2O2S — CID 54282779
4-hydroxy-5-(2-methylsulfanylethyl)-3-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-one (PubChem CID 54282779) has the molecular formula C13H13F3N2O2S and a molecular weight of 318.32 g/mol. Its IUPAC name is 4-hydroxy-5-(2-methylsulfanylethyl)-3-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-one.
| Compound Name | 4-hydroxy-5-(2-methylsulfanylethyl)-3-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-one |
|---|---|
| PubChem CID | 54282779 |
| Molecular Formula | C13H13F3N2O2S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 4-hydroxy-5-(2-methylsulfanylethyl)-3-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-one |
| SMILES | CSCCc1[nH]c(=O)n(-c2cccc(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C13H13F3N2O2S/c1-21-6-5-10-11(19)18(12(20)17-10)9-4-2-3-8(7-9)13(14,15)16/h2-4,7,19H,5-6H2,1H3,(H,17,20) |
| InChIKey | RRYVQGKCYVXVJO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |