C13H9F3N2O3 — CID 80649586
5-acetyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-2,4-dione (PubChem CID 80649586) has the molecular formula C13H9F3N2O3 and a molecular weight of 298.22 g/mol. Its IUPAC name is 5-acetyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-acetyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 80649586 |
| Molecular Formula | C13H9F3N2O3 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 5-acetyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-2,4-dione |
| SMILES | CC(=O)c1c[nH]c(=O)n(-c2cccc(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C13H9F3N2O3/c1-7(19)10-6-17-12(21)18(11(10)20)9-4-2-3-8(5-9)13(14,15)16/h2-6H,1H3,(H,17,21) |
| InChIKey | AUIMXPLRMZZUMX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |