C13H10N2O5 — CID 80643686
5-acetyl-3-(1,3-benzodioxol-5-yl)-1H-pyrimidine-2,4-dione (PubChem CID 80643686) has the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. Its IUPAC name is 5-acetyl-3-(1,3-benzodioxol-5-yl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-acetyl-3-(1,3-benzodioxol-5-yl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 80643686 |
| Molecular Formula | C13H10N2O5 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 5-acetyl-3-(1,3-benzodioxol-5-yl)-1H-pyrimidine-2,4-dione |
| SMILES | CC(=O)c1c[nH]c(=O)n(-c2ccc3c(c2)OCO3)c1=O |
| InChI | InChI=1S/C13H10N2O5/c1-7(16)9-5-14-13(18)15(12(9)17)8-2-3-10-11(4-8)20-6-19-10/h2-5H,6H2,1H3,(H,14,18) |
| InChIKey | WNLWSKVBSOQDOI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |