C14H9BrF3NO3 — CID 143779393
5-bromo-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid (PubChem CID 143779393) has the molecular formula C14H9BrF3NO3 and a molecular weight of 376.13 g/mol. Its IUPAC name is 5-bromo-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid.
| Compound Name | 5-bromo-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 143779393 |
| Molecular Formula | C14H9BrF3NO3 |
| Molecular Weight | 376.13 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 5-bromo-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid |
| SMILES | Cc1c(Br)cc(C(=O)O)c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H9BrF3NO3/c1-7-11(15)6-10(13(21)22)12(20)19(7)9-4-2-3-8(5-9)14(16,17)18/h2-6H,1H3,(H,21,22) |
| InChIKey | RWAPUNSLQSPBPI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.13 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |