C20H15F3N2O4S — CID 70304322
5-(4-aminophenyl)sulfinyl-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid (PubChem CID 70304322) has the molecular formula C20H15F3N2O4S and a molecular weight of 436.41 g/mol. Its IUPAC name is 5-(4-aminophenyl)sulfinyl-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid.
| Compound Name | 5-(4-aminophenyl)sulfinyl-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70304322 |
| Molecular Formula | C20H15F3N2O4S |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 5-(4-aminophenyl)sulfinyl-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid |
| SMILES | Cc1c(S(=O)c2ccc(N)cc2)cc(C(=O)O)c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H15F3N2O4S/c1-11-17(30(29)15-7-5-13(24)6-8-15)10-16(19(27)28)18(26)25(11)14-4-2-3-12(9-14)20(21,22)23/h2-10H,24H2,1H3,(H,27,28) |
| InChIKey | MEACRCVKHLYMLX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|