C13H8FN3O3 — CID 80643209
5-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-2-fluorobenzonitrile (PubChem CID 80643209) has the molecular formula C13H8FN3O3 and a molecular weight of 273.22 g/mol. Its IUPAC name is 5-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-2-fluorobenzonitrile.
| Compound Name | 5-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 80643209 |
| Molecular Formula | C13H8FN3O3 |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 5-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-2-fluorobenzonitrile |
| SMILES | CC(=O)c1c[nH]c(=O)n(-c2ccc(F)c(C#N)c2)c1=O |
| InChI | InChI=1S/C13H8FN3O3/c1-7(18)10-6-16-13(20)17(12(10)19)9-2-3-11(14)8(4-9)5-15/h2-4,6H,1H3,(H,16,20) |
| InChIKey | RXAFNJUMWRDSJY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |