C11H9N3O3 — CID 80643260
5-acetyl-3-pyridin-3-yl-1H-pyrimidine-2,4-dione (PubChem CID 80643260) has the molecular formula C11H9N3O3 and a molecular weight of 231.21 g/mol. Its IUPAC name is 5-acetyl-3-pyridin-3-yl-1H-pyrimidine-2,4-dione.
| Compound Name | 5-acetyl-3-pyridin-3-yl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 80643260 |
| Molecular Formula | C11H9N3O3 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 5-acetyl-3-pyridin-3-yl-1H-pyrimidine-2,4-dione |
| SMILES | CC(=O)c1c[nH]c(=O)n(-c2cccnc2)c1=O |
| InChI | InChI=1S/C11H9N3O3/c1-7(15)9-6-13-11(17)14(10(9)16)8-3-2-4-12-5-8/h2-6H,1H3,(H,13,17) |
| InChIKey | KRSNBMPJSDVTGD-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |