C18H10F3N3O — CID 151378917
10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one (PubChem CID 151378917) has the molecular formula C18H10F3N3O and a molecular weight of 341.29 g/mol. Its IUPAC name is 10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one.
| Compound Name | 10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one |
|---|---|
| PubChem CID | 151378917 |
| Molecular Formula | C18H10F3N3O |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one |
| SMILES | O=c1ccc2cnc3cccnc3c2n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H10F3N3O/c19-18(20,21)12-3-1-4-13(9-12)24-15(25)7-6-11-10-23-14-5-2-8-22-16(14)17(11)24/h1-10H |
| InChIKey | ORZMFCBLJNTLFZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|