C19H15FN4O5 — CID 168952856
3-fluoro-4-[[3-(2-methoxyethyl)-6-nitro-2,4-dioxoquinazolin-1-yl]methyl]benzonitrile (PubChem CID 168952856) has the molecular formula C19H15FN4O5 and a molecular weight of 398.35 g/mol. Its IUPAC name is 3-fluoro-4-[[3-(2-methoxyethyl)-6-nitro-2,4-dioxoquinazolin-1-yl]methyl]benzonitrile.
| Compound Name | 3-fluoro-4-[[3-(2-methoxyethyl)-6-nitro-2,4-dioxoquinazolin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 168952856 |
| Molecular Formula | C19H15FN4O5 |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 3-fluoro-4-[[3-(2-methoxyethyl)-6-nitro-2,4-dioxoquinazolin-1-yl]methyl]benzonitrile |
| SMILES | COCCn1c(=O)c2cc([N+](=O)[O-])ccc2n(Cc2ccc(C#N)cc2F)c1=O |
| InChI | InChI=1S/C19H15FN4O5/c1-29-7-6-22-18(25)15-9-14(24(27)28)4-5-17(15)23(19(22)26)11-13-3-2-12(10-21)8-16(13)20/h2-5,8-9H,6-7,11H2,1H3 |
| InChIKey | BXBLBBRZIVGWPT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 120.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|