C19H15IN4O6 — CID 10142825
5-iodo-6-methyl-1,3-bis[(4-nitrophenyl)methyl]pyrimidine-2,4-dione (PubChem CID 10142825) has the molecular formula C19H15IN4O6 and a molecular weight of 522.26 g/mol. Its IUPAC name is 5-iodo-6-methyl-1,3-bis[(4-nitrophenyl)methyl]pyrimidine-2,4-dione.
| Compound Name | 5-iodo-6-methyl-1,3-bis[(4-nitrophenyl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10142825 |
| Molecular Formula | C19H15IN4O6 |
| Molecular Weight | 522.26 g/mol |
| Exact Mass | 522.00 |
| IUPAC Name | 5-iodo-6-methyl-1,3-bis[(4-nitrophenyl)methyl]pyrimidine-2,4-dione |
| SMILES | Cc1c(I)c(=O)n(Cc2ccc([N+](=O)[O-])cc2)c(=O)n1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H15IN4O6/c1-12-17(20)18(25)22(11-14-4-8-16(9-5-14)24(29)30)19(26)21(12)10-13-2-6-15(7-3-13)23(27)28/h2-9H,10-11H2,1H3 |
| InChIKey | LPUOGPVRYRJLTK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 130.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|