C21H21N3O6 — CID 87725856
1,3-bis[(4-methoxyphenyl)methyl]-6-methyl-5-nitropyrimidine-2,4-dione (PubChem CID 87725856) has the molecular formula C21H21N3O6 and a molecular weight of 411.41 g/mol. Its IUPAC name is 1,3-bis[(4-methoxyphenyl)methyl]-6-methyl-5-nitropyrimidine-2,4-dione.
| Compound Name | 1,3-bis[(4-methoxyphenyl)methyl]-6-methyl-5-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87725856 |
| Molecular Formula | C21H21N3O6 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 1,3-bis[(4-methoxyphenyl)methyl]-6-methyl-5-nitropyrimidine-2,4-dione |
| SMILES | COc1ccc(Cn2c(C)c([N+](=O)[O-])c(=O)n(Cc3ccc(OC)cc3)c2=O)cc1 |
| InChI | InChI=1S/C21H21N3O6/c1-14-19(24(27)28)20(25)23(13-16-6-10-18(30-3)11-7-16)21(26)22(14)12-15-4-8-17(29-2)9-5-15/h4-11H,12-13H2,1-3H3 |
| InChIKey | QQXQPOMHCZPKFR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 105.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|