C19H25N5O5 — CID 9355255
6-amino-1-butyl-5-morpholin-4-yl-3-[(4-nitrophenyl)methyl]pyrimidine-2,4-dione (PubChem CID 9355255) has the molecular formula C19H25N5O5 and a molecular weight of 403.44 g/mol. Its IUPAC name is 6-amino-1-butyl-5-morpholin-4-yl-3-[(4-nitrophenyl)methyl]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-butyl-5-morpholin-4-yl-3-[(4-nitrophenyl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 9355255 |
| Molecular Formula | C19H25N5O5 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 6-amino-1-butyl-5-morpholin-4-yl-3-[(4-nitrophenyl)methyl]pyrimidine-2,4-dione |
| SMILES | CCCCn1c(N)c(N2CCOCC2)c(=O)n(Cc2ccc([N+](=O)[O-])cc2)c1=O |
| InChI | InChI=1S/C19H25N5O5/c1-2-3-8-22-17(20)16(21-9-11-29-12-10-21)18(25)23(19(22)26)13-14-4-6-15(7-5-14)24(27)28/h4-7H,2-3,8-13,20H2,1H3 |
| InChIKey | WPJHPCFOVPLDAT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|