C21H25N5O8 — CID 16959034
[2-(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate (PubChem CID 16959034) has the molecular formula C21H25N5O8 and a molecular weight of 475.46 g/mol. Its IUPAC name is [2-(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate.
| Compound Name | [2-(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate |
|---|---|
| PubChem CID | 16959034 |
| Molecular Formula | C21H25N5O8 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | [2-(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate |
| SMILES | CCCn1c(N)c(C(=O)COC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C21H25N5O8/c1-3-6-25-18(22)17(19(28)23(2)21(25)30)16(27)12-34-20(29)14-11-13(26(31)32)4-5-15(14)24-7-9-33-10-8-24/h4-5,11H,3,6-10,12,22H2,1-2H3 |
| InChIKey | UMPLYYNBCAASJU-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|