C14H14N2O3 — CID 23008585
2,5-dimethyl-1-[(4-nitrophenyl)methyl]pyrrole-3-carbaldehyde (PubChem CID 23008585) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 2,5-dimethyl-1-[(4-nitrophenyl)methyl]pyrrole-3-carbaldehyde.
| Compound Name | 2,5-dimethyl-1-[(4-nitrophenyl)methyl]pyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 23008585 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2,5-dimethyl-1-[(4-nitrophenyl)methyl]pyrrole-3-carbaldehyde |
| SMILES | Cc1cc(C=O)c(C)n1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H14N2O3/c1-10-7-13(9-17)11(2)15(10)8-12-3-5-14(6-4-12)16(18)19/h3-7,9H,8H2,1-2H3 |
| InChIKey | HVSHYXBKLDDPCX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 65.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|