C15H8N2O2S — CID 10858874
13-nitro-17-thia-15-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene (PubChem CID 10858874) has the molecular formula C15H8N2O2S and a molecular weight of 280.31 g/mol. Its IUPAC name is 13-nitro-17-thia-15-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene.
| Compound Name | 13-nitro-17-thia-15-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene |
|---|---|
| PubChem CID | 10858874 |
| Molecular Formula | C15H8N2O2S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 13-nitro-17-thia-15-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene |
| SMILES | O=[N+]([O-])c1cnc2sc3cc4ccccc4cc3c2c1 |
| InChI | InChI=1S/C15H8N2O2S/c18-17(19)11-7-13-12-5-9-3-1-2-4-10(9)6-14(12)20-15(13)16-8-11/h1-8H |
| InChIKey | GLFLWZPLVTZBRI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|