C8H6N6O3 — CID 55239598
5-nitro-2-(1,2,4-triazol-1-yl)pyridine-3-carboxamide (PubChem CID 55239598) has the molecular formula C8H6N6O3 and a molecular weight of 234.18 g/mol. Its IUPAC name is 5-nitro-2-(1,2,4-triazol-1-yl)pyridine-3-carboxamide.
| Compound Name | 5-nitro-2-(1,2,4-triazol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55239598 |
| Molecular Formula | C8H6N6O3 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 5-nitro-2-(1,2,4-triazol-1-yl)pyridine-3-carboxamide |
| SMILES | NC(=O)c1cc([N+](=O)[O-])cnc1-n1cncn1 |
| InChI | InChI=1S/C8H6N6O3/c9-7(15)6-1-5(14(16)17)2-11-8(6)13-4-10-3-12-13/h1-4H,(H2,9,15) |
| InChIKey | RBFIWKHMSNCDES-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|