C9H6N4O4 — CID 16789625
5-nitro-2-(1,2,4-triazol-1-yl)benzoic acid (PubChem CID 16789625) has the molecular formula C9H6N4O4 and a molecular weight of 234.17 g/mol. Its IUPAC name is 5-nitro-2-(1,2,4-triazol-1-yl)benzoic acid.
| Compound Name | 5-nitro-2-(1,2,4-triazol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 16789625 |
| Molecular Formula | C9H6N4O4 |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 5-nitro-2-(1,2,4-triazol-1-yl)benzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])ccc1-n1cncn1 |
| InChI | InChI=1S/C9H6N4O4/c14-9(15)7-3-6(13(16)17)1-2-8(7)12-5-10-4-11-12/h1-5H,(H,14,15) |
| InChIKey | DYXSOBOFSHIDEF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|