C11H15N5O3 — CID 55104538
2-(2-methylpiperazin-1-yl)-5-nitropyridine-3-carboxamide (PubChem CID 55104538) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-(2-methylpiperazin-1-yl)-5-nitropyridine-3-carboxamide.
| Compound Name | 2-(2-methylpiperazin-1-yl)-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 55104538 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-(2-methylpiperazin-1-yl)-5-nitropyridine-3-carboxamide |
| SMILES | CC1CNCCN1c1ncc([N+](=O)[O-])cc1C(N)=O |
| InChI | InChI=1S/C11H15N5O3/c1-7-5-13-2-3-15(7)11-9(10(12)17)4-8(6-14-11)16(18)19/h4,6-7,13H,2-3,5H2,1H3,(H2,12,17) |
| InChIKey | FFBNBTOLMTYCNK-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|