C15H18N6O3S — CID 133476732
5-nitro-2-[4-[1-(1,3-thiazol-2-yl)ethyl]piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 133476732) has the molecular formula C15H18N6O3S and a molecular weight of 362.42 g/mol. Its IUPAC name is 5-nitro-2-[4-[1-(1,3-thiazol-2-yl)ethyl]piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | 5-nitro-2-[4-[1-(1,3-thiazol-2-yl)ethyl]piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133476732 |
| Molecular Formula | C15H18N6O3S |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 5-nitro-2-[4-[1-(1,3-thiazol-2-yl)ethyl]piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | CC(c1nccs1)N1CCN(c2ncc([N+](=O)[O-])cc2C(N)=O)CC1 |
| InChI | InChI=1S/C15H18N6O3S/c1-10(15-17-2-7-25-15)19-3-5-20(6-4-19)14-12(13(16)22)8-11(9-18-14)21(23)24/h2,7-10H,3-6H2,1H3,(H2,16,22) |
| InChIKey | ISKHLPFQUYMYAJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|